C20H17N3O2 — CID 5375697
N'-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclopropyloxamide (PubChem CID 5375697) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N'-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 5375697 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N'-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclopropyloxamide |
| SMILES | O=C(N/N=C\c1c2ccccc2cc2ccccc12)C(=O)NC1CC1 |
| InChI | InChI=1S/C20H17N3O2/c24-19(22-15-9-10-15)20(25)23-21-12-18-16-7-3-1-5-13(16)11-14-6-2-4-8-17(14)18/h1-8,11-12,15H,9-10H2,(H,22,24)(H,23,25)/b21-12- |
| InChIKey | WGAROQIAQGRASW-MTJSOVHGSA-N |
| XLogP | 2.72 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|