C25H20N2O — CID 40553633
(1S,2R)-N-[(Z)-anthracen-9-ylmethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 40553633) has the molecular formula C25H20N2O and a molecular weight of 364.45 g/mol. Its IUPAC name is (1S,2R)-N-[(Z)-anthracen-9-ylmethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | (1S,2R)-N-[(Z)-anthracen-9-ylmethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40553633 |
| Molecular Formula | C25H20N2O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (1S,2R)-N-[(Z)-anthracen-9-ylmethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1c2ccccc2cc2ccccc12)[C@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H20N2O/c28-25(23-15-22(23)17-8-2-1-3-9-17)27-26-16-24-20-12-6-4-10-18(20)14-19-11-5-7-13-21(19)24/h1-14,16,22-23H,15H2,(H,27,28)/b26-16-/t22-,23-/m0/s1 |
| InChIKey | ZQFSQCRNPJNROF-GRUBFYOHSA-N |
| XLogP | 5.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|