C26H28N2O2 — CID 7332037
trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 7332037) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7332037 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | COc1ccc2ccccc2c1/C=N/NC(=O)[C@@H]1C[C@H]1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-26(2,3)19-12-9-18(10-13-19)21-15-22(21)25(29)28-27-16-23-20-8-6-5-7-17(20)11-14-24(23)30-4/h5-14,16,21-22H,15H2,1-4H3,(H,28,29)/b27-16+/t21-,22+/m0/s1 |
| InChIKey | IIBUWZNCIKUHBQ-TVSFNBRFSA-N |
| XLogP | 5.40 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|