C23H25N3O — CID 136774398
trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]cyclopropane-1-carboxamide (PubChem CID 136774398) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136774398 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(Z)-1H-indol-3-ylmethylideneamino]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2C[C@H]2C(=O)N/N=C\c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-23(2,3)17-10-8-15(9-11-17)19-12-20(19)22(27)26-25-14-16-13-24-21-7-5-4-6-18(16)21/h4-11,13-14,19-20,24H,12H2,1-3H3,(H,26,27)/b25-14-/t19-,20+/m0/s1 |
| InChIKey | TYVDUVPTMGWEIJ-DCYFIGPQSA-N |
| XLogP | 4.72 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|