C25H32N2O2 — CID 136896457
cis-(1S,2R)-N-[(E)-(5-tert-butyl-2-hydroxyphenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide (PubChem CID 136896457) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(E)-(5-tert-butyl-2-hydroxyphenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(E)-(5-tert-butyl-2-hydroxyphenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136896457 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | cis-(1S,2R)-N-[(E)-(5-tert-butyl-2-hydroxyphenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2C[C@@H]2C(=O)N/N=C/c2cc(C(C)(C)C)ccc2O)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-24(2,3)18-9-7-16(8-10-18)20-14-21(20)23(29)27-26-15-17-13-19(25(4,5)6)11-12-22(17)28/h7-13,15,20-21,28H,14H2,1-6H3,(H,27,29)/b26-15+/t20-,21-/m0/s1 |
| InChIKey | VSVCXJPGUWFMPR-CPGDBGJXSA-N |
| XLogP | 5.24 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|