C23H28N2O3 — CID 3110299
2-(4-tert-butylphenyl)-N-[(2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 3110299) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[(2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[(2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3110299 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[(2,4-dihydroxy-3,6-dimethylphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | Cc1cc(O)c(C)c(O)c1C=NNC(=O)C1CC1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-13-10-20(26)14(2)21(27)19(13)12-24-25-22(28)18-11-17(18)15-6-8-16(9-7-15)23(3,4)5/h6-10,12,17-18,26-27H,11H2,1-5H3,(H,25,28) |
| InChIKey | HDMNIXXRQRLJST-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|