C22H23N2O3- — CID 7259971
4-[[[(1R,2S)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]benzoate (PubChem CID 7259971) has the molecular formula C22H23N2O3- and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-[[[(1R,2S)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[[[(1R,2S)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7259971 |
| Molecular Formula | C22H23N2O3- |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-[[[(1R,2S)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]benzoate |
| SMILES | CC(C)(C)c1ccc([C@H]2C[C@H]2C(=O)NN=Cc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-22(2,3)17-10-8-15(9-11-17)18-12-19(18)20(25)24-23-13-14-4-6-16(7-5-14)21(26)27/h4-11,13,18-19H,12H2,1-3H3,(H,24,25)(H,26,27)/p-1/t18-,19-/m1/s1 |
| InChIKey | XYIDJLMIMJSDJT-RTBURBONSA-M |
| XLogP | 2.60 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|