C29H29N3O5 — CID 4204674
[4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate (PubChem CID 4204674) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is [4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate.
| Compound Name | [4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 4204674 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)Oc2ccc(C=NNC(=O)C3CC3c3ccc(C(C)(C)C)cc3)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H29N3O5/c1-18-15-21(9-14-26(18)32(35)36)28(34)37-23-12-5-19(6-13-23)17-30-31-27(33)25-16-24(25)20-7-10-22(11-8-20)29(2,3)4/h5-15,17,24-25H,16H2,1-4H3,(H,31,33) |
| InChIKey | ZJLJIUJLFZGTMJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|