C28H26Cl2N2O3 — CID 3112310
[4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3112310) has the molecular formula C28H26Cl2N2O3 and a molecular weight of 509.43 g/mol. Its IUPAC name is [4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3112310 |
| Molecular Formula | C28H26Cl2N2O3 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | [4-[[[2-(4-tert-butylphenyl)cyclopropanecarbonyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CC(C)(C)c1ccc(C2CC2C(=O)NN=Cc2ccc(OC(=O)c3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H26Cl2N2O3/c1-28(2,3)19-8-6-18(7-9-19)23-15-24(23)26(33)32-31-16-17-4-11-21(12-5-17)35-27(34)22-13-10-20(29)14-25(22)30/h4-14,16,23-24H,15H2,1-3H3,(H,32,33) |
| InChIKey | CJOYDLIVWDNREM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|