C25H19Cl2N3O4 — CID 3117400
[4-[[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3117400) has the molecular formula C25H19Cl2N3O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is [4-[[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3117400 |
| Molecular Formula | C25H19Cl2N3O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [4-[[(2-oxo-4-phenylpyrrolidine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)C2C(=O)NCC2c2ccccc2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H19Cl2N3O4/c26-17-8-11-19(21(27)12-17)25(33)34-18-9-6-15(7-10-18)13-29-30-24(32)22-20(14-28-23(22)31)16-4-2-1-3-5-16/h1-13,20,22H,14H2,(H,28,31)(H,30,32) |
| InChIKey | PBPFSRLMQSBUEX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|