C21H23N3O2 — CID 35796860
(3S,4R)-2-oxo-4-phenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolidine-3-carboxamide (PubChem CID 35796860) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3S,4R)-2-oxo-4-phenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-2-oxo-4-phenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 35796860 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (3S,4R)-2-oxo-4-phenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]pyrrolidine-3-carboxamide |
| SMILES | CC(C)c1ccc(/C=N/NC(=O)[C@@H]2C(=O)NC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-14(2)16-10-8-15(9-11-16)12-23-24-21(26)19-18(13-22-20(19)25)17-6-4-3-5-7-17/h3-12,14,18-19H,13H2,1-2H3,(H,22,25)(H,24,26)/b23-12+/t18-,19-/m0/s1 |
| InChIKey | JMBKDMVNXBNTLQ-GGJQROPYSA-N |
| XLogP | 2.79 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|