C21H23N3O5 — CID 98233687
(3S,4R)-2-oxo-4-phenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide (PubChem CID 98233687) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is (3S,4R)-2-oxo-4-phenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-2-oxo-4-phenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 98233687 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (3S,4R)-2-oxo-4-phenyl-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)[C@@H]2C(=O)NC[C@H]2c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O5/c1-27-16-9-13(10-17(28-2)19(16)29-3)11-23-24-21(26)18-15(12-22-20(18)25)14-7-5-4-6-8-14/h4-11,15,18H,12H2,1-3H3,(H,22,25)(H,24,26)/b23-11+/t15-,18-/m0/s1 |
| InChIKey | UUEXATSYEVCZBU-UPIMUTOLSA-N |
| XLogP | 1.69 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|