C20H20IN3O4 — CID 135620135
N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 135620135) has the molecular formula C20H20IN3O4 and a molecular weight of 493.30 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 135620135 |
| Molecular Formula | C20H20IN3O4 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C2C(=O)NCC2c2ccccc2)cc(I)c1O |
| InChI | InChI=1S/C20H20IN3O4/c1-2-28-16-9-12(8-15(21)18(16)25)10-23-24-20(27)17-14(11-22-19(17)26)13-6-4-3-5-7-13/h3-10,14,17,25H,2,11H2,1H3,(H,22,26)(H,24,27)/b23-10- |
| InChIKey | XMZNSYMMUJFINW-RMORIDSASA-N |
| XLogP | 2.38 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|