C19H18Cl2N2O4 — CID 3555201
[4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3555201) has the molecular formula C19H18Cl2N2O4 and a molecular weight of 409.27 g/mol. Its IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3555201 |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [4-[[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CC(C)(C)OC(=O)NN=Cc1ccc(OC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O4/c1-19(2,3)27-18(25)23-22-11-12-4-7-14(8-5-12)26-17(24)15-9-6-13(20)10-16(15)21/h4-11H,1-3H3,(H,23,25) |
| InChIKey | HRDDDRCZDCVGCQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|