C28H18Cl4N2O5 — CID 3544117
[4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 3544117) has the molecular formula C28H18Cl4N2O5 and a molecular weight of 604.27 g/mol. Its IUPAC name is [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3544117 |
| Molecular Formula | C28H18Cl4N2O5 |
| Molecular Weight | 604.27 g/mol |
| Exact Mass | 602.00 |
| IUPAC Name | [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=O)C(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H18Cl4N2O5/c29-18-3-10-22(11-4-18)38-28(39-23-12-5-19(30)6-13-23)26(35)34-33-16-17-1-8-21(9-2-17)37-27(36)24-14-7-20(31)15-25(24)32/h1-16,28H,(H,34,35) |
| InChIKey | GEJCXHLCPIECIW-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.27 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|