C20H13Cl3N2O4S — CID 4132128
[4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 4132128) has the molecular formula C20H13Cl3N2O4S and a molecular weight of 483.76 g/mol. Its IUPAC name is [4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4132128 |
| Molecular Formula | C20H13Cl3N2O4S |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 481.97 |
| IUPAC Name | [4-[[(4-chlorophenyl)sulfonylhydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(C=NNS(=O)(=O)c2ccc(Cl)cc2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl3N2O4S/c21-14-3-8-17(9-4-14)30(27,28)25-24-12-13-1-6-16(7-2-13)29-20(26)18-10-5-15(22)11-19(18)23/h1-12,25H |
| InChIKey | XVPOFWFYOHXHON-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|