C28H20Cl2N2O4 — CID 41271342
[4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 41271342) has the molecular formula C28H20Cl2N2O4 and a molecular weight of 519.38 g/mol. Its IUPAC name is [4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 41271342 |
| Molecular Formula | C28H20Cl2N2O4 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | [4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N\NC(=O)C(O)(c2ccccc2)c2ccccc2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H20Cl2N2O4/c29-22-13-16-24(25(30)17-22)26(33)36-23-14-11-19(12-15-23)18-31-32-27(34)28(35,20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-18,35H,(H,32,34)/b31-18- |
| InChIKey | WTCJMVAORNVBIK-MNBJERMJSA-N |
| XLogP | 5.60 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|