C29H22Cl2N2O5 — CID 4611165
[4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 4611165) has the molecular formula C29H22Cl2N2O5 and a molecular weight of 549.41 g/mol. Its IUPAC name is [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 4611165 |
| Molecular Formula | C29H22Cl2N2O5 |
| Molecular Weight | 549.41 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc(C=NNC(=O)C(Oc2ccc(Cl)cc2)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H22Cl2N2O5/c1-19-4-2-3-5-26(19)28(35)36-23-12-6-20(7-13-23)18-32-33-27(34)29(37-24-14-8-21(30)9-15-24)38-25-16-10-22(31)11-17-25/h2-18,29H,1H3,(H,33,34) |
| InChIKey | XOCURHXNMAYTQY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|