C16H15N3O3 — CID 6022391
[4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-methylbenzoate (PubChem CID 6022391) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 6022391 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc(/C=N\NC(N)=O)cc1 |
| InChI | InChI=1S/C16H15N3O3/c1-11-4-2-3-5-14(11)15(20)22-13-8-6-12(7-9-13)10-18-19-16(17)21/h2-10H,1H3,(H3,17,19,21)/b18-10- |
| InChIKey | QUDPIFXJGAQRDM-ZDLGFXPLSA-N |
| XLogP | 2.22 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|