C15H12IN3O3 — CID 6024810
[4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-iodobenzoate (PubChem CID 6024810) has the molecular formula C15H12IN3O3 and a molecular weight of 409.18 g/mol. Its IUPAC name is [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 6024810 |
| Molecular Formula | C15H12IN3O3 |
| Molecular Weight | 409.18 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | [4-[(Z)-(carbamoylhydrazinylidene)methyl]phenyl] 2-iodobenzoate |
| SMILES | NC(=O)N/N=C\c1ccc(OC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C15H12IN3O3/c16-13-4-2-1-3-12(13)14(20)22-11-7-5-10(6-8-11)9-18-19-15(17)21/h1-9H,(H3,17,19,21)/b18-9- |
| InChIKey | FTZOWSPCWCVAND-NVMNQCDNSA-N |
| XLogP | 2.51 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|