C21H22IN3O2S — CID 3485483
[4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-iodobenzoate (PubChem CID 3485483) has the molecular formula C21H22IN3O2S and a molecular weight of 507.40 g/mol. Its IUPAC name is [4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 3485483 |
| Molecular Formula | C21H22IN3O2S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | [4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]phenyl] 2-iodobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=S)NC2CCCCC2)cc1)c1ccccc1I |
| InChI | InChI=1S/C21H22IN3O2S/c22-19-9-5-4-8-18(19)20(26)27-17-12-10-15(11-13-17)14-23-25-21(28)24-16-6-2-1-3-7-16/h4-5,8-14,16H,1-3,6-7H2,(H2,24,25,28) |
| InChIKey | LLXJLTVQWNYALH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|