C19H15IN4O3 — CID 3736032
[4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 3736032) has the molecular formula C19H15IN4O3 and a molecular weight of 474.26 g/mol. Its IUPAC name is [4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 3736032 |
| Molecular Formula | C19H15IN4O3 |
| Molecular Weight | 474.26 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | [4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | Cc1cc(C(=O)NN=Cc2ccc(OC(=O)c3ccccc3I)cc2)n[nH]1 |
| InChI | InChI=1S/C19H15IN4O3/c1-12-10-17(23-22-12)18(25)24-21-11-13-6-8-14(9-7-13)27-19(26)15-4-2-3-5-16(15)20/h2-11H,1H3,(H,22,23)(H,24,25) |
| InChIKey | XFYQOFUKDYEUQG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|