C20H17IN4O4 — CID 6154171
[2-methoxy-4-[(Z)-[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 6154171) has the molecular formula C20H17IN4O4 and a molecular weight of 504.28 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [2-methoxy-4-[(Z)-[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 6154171 |
| Molecular Formula | C20H17IN4O4 |
| Molecular Weight | 504.28 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | [2-methoxy-4-[(Z)-[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(C)[nH]n2)ccc1OC(=O)c1ccccc1I |
| InChI | InChI=1S/C20H17IN4O4/c1-12-9-16(24-23-12)19(26)25-22-11-13-7-8-17(18(10-13)28-2)29-20(27)14-5-3-4-6-15(14)21/h3-11H,1-2H3,(H,23,24)(H,25,26)/b22-11- |
| InChIKey | SRCZAAAPZNWDEC-JJFYIABZSA-N |
| XLogP | 3.31 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|