C17H15IN2O4 — CID 1008577
[4-[[(2-iodobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 1008577) has the molecular formula C17H15IN2O4 and a molecular weight of 438.22 g/mol. Its IUPAC name is [4-[[(2-iodobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[[(2-iodobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1008577 |
| Molecular Formula | C17H15IN2O4 |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | [4-[[(2-iodobenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=NNC(=O)c2ccccc2I)ccc1OC(C)=O |
| InChI | InChI=1S/C17H15IN2O4/c1-11(21)24-15-8-7-12(9-16(15)23-2)10-19-20-17(22)13-5-3-4-6-14(13)18/h3-10H,1-2H3,(H,20,22) |
| InChIKey | NKHXJKBZKBSKNM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|