C19H18BrN3O5 — CID 3503807
[4-[[[2-[(2-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 3503807) has the molecular formula C19H18BrN3O5 and a molecular weight of 448.27 g/mol. Its IUPAC name is [4-[[[2-[(2-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[[[2-[(2-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 3503807 |
| Molecular Formula | C19H18BrN3O5 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | [4-[[[2-[(2-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=NNC(=O)CNC(=O)c2ccccc2Br)ccc1OC(C)=O |
| InChI | InChI=1S/C19H18BrN3O5/c1-12(24)28-16-8-7-13(9-17(16)27-2)10-22-23-18(25)11-21-19(26)14-5-3-4-6-15(14)20/h3-10H,11H2,1-2H3,(H,21,26)(H,23,25) |
| InChIKey | OGBMNRNQZZOPET-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|