C19H14Cl2N4O3 — CID 5009388
[4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 5009388) has the molecular formula C19H14Cl2N4O3 and a molecular weight of 417.25 g/mol. Its IUPAC name is [4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 5009388 |
| Molecular Formula | C19H14Cl2N4O3 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | [4-[[(5-methyl-1H-pyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | Cc1cc(C(=O)NN=Cc2ccc(OC(=O)c3ccc(Cl)cc3Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C19H14Cl2N4O3/c1-11-8-17(24-23-11)18(26)25-22-10-12-2-5-14(6-3-12)28-19(27)15-7-4-13(20)9-16(15)21/h2-10H,1H3,(H,23,24)(H,25,26) |
| InChIKey | AZPBZIUUYWJSDM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|