C24H20IN3O5 — CID 4674193
[4-[[[2-(4-ethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 4674193) has the molecular formula C24H20IN3O5 and a molecular weight of 557.34 g/mol. Its IUPAC name is [4-[[[2-(4-ethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [4-[[[2-(4-ethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 4674193 |
| Molecular Formula | C24H20IN3O5 |
| Molecular Weight | 557.34 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | [4-[[[2-(4-ethoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | CCOc1ccc(NC(=O)C(=O)NN=Cc2ccc(OC(=O)c3ccccc3I)cc2)cc1 |
| InChI | InChI=1S/C24H20IN3O5/c1-2-32-18-13-9-17(10-14-18)27-22(29)23(30)28-26-15-16-7-11-19(12-8-16)33-24(31)20-5-3-4-6-21(20)25/h3-15H,2H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | KFLAXEHCPHKCQN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|