C31H25BrN4O6 — CID 5235607
[4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 5235607) has the molecular formula C31H25BrN4O6 and a molecular weight of 629.47 g/mol. Its IUPAC name is [4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 5235607 |
| Molecular Formula | C31H25BrN4O6 |
| Molecular Weight | 629.47 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | [4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2ccc(OC(=O)c3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H25BrN4O6/c1-2-41-24-17-13-23(14-18-24)34-28(37)26-5-3-4-6-27(26)35-29(38)30(39)36-33-19-20-7-15-25(16-8-20)42-31(40)21-9-11-22(32)12-10-21/h3-19H,2H2,1H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | QOGHRJUDKHMODO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|