C33H28N4O6 — CID 4094463
[4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4094463) has the molecular formula C33H28N4O6 and a molecular weight of 576.61 g/mol. Its IUPAC name is [4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4094463 |
| Molecular Formula | C33H28N4O6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | [4-[[[2-[2-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-phenylprop-2-enoate |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2ccc(OC(=O)C=Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H28N4O6/c1-2-42-26-19-15-25(16-20-26)35-31(39)28-10-6-7-11-29(28)36-32(40)33(41)37-34-22-24-12-17-27(18-13-24)43-30(38)21-14-23-8-4-3-5-9-23/h3-22H,2H2,1H3,(H,35,39)(H,36,40)(H,37,41) |
| InChIKey | OOWBCFXGECVIGF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|