C32H27ClN4O6 — CID 6036898
[4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate (PubChem CID 6036898) has the molecular formula C32H27ClN4O6 and a molecular weight of 599.04 g/mol. Its IUPAC name is [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 6036898 |
| Molecular Formula | C32H27ClN4O6 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [4-[(Z)-[[2-[2-[(4-chlorophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N\NC(=O)C(=O)Nc3ccccc3C(=O)Nc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H27ClN4O6/c1-2-19-42-25-17-9-22(10-18-25)32(41)43-26-15-7-21(8-16-26)20-34-37-31(40)30(39)36-28-6-4-3-5-27(28)29(38)35-24-13-11-23(33)12-14-24/h3-18,20H,2,19H2,1H3,(H,35,38)(H,36,39)(H,37,40)/b34-20- |
| InChIKey | GVWRLEGDJWGXFH-GXBUFBABSA-N |
| XLogP | 5.69 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|