C34H31BrN4O7 — CID 4610655
[4-[[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate (PubChem CID 4610655) has the molecular formula C34H31BrN4O7 and a molecular weight of 687.55 g/mol. Its IUPAC name is [4-[[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate.
| Compound Name | [4-[[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 4610655 |
| Molecular Formula | C34H31BrN4O7 |
| Molecular Weight | 687.55 g/mol |
| Exact Mass | 686.14 |
| IUPAC Name | [4-[[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3ccccc3C(=O)Nc3ccc(Br)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C34H31BrN4O7/c1-3-4-19-45-26-16-10-23(11-17-26)34(43)46-29-18-9-22(20-30(29)44-2)21-36-39-33(42)32(41)38-28-8-6-5-7-27(28)31(40)37-25-14-12-24(35)13-15-25/h5-18,20-21H,3-4,19H2,1-2H3,(H,37,40)(H,38,41)(H,39,42) |
| InChIKey | JVOZFBNXWPMKPR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|