C31H26N4O7 — CID 4249535
[2-methoxy-4-[[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 4249535) has the molecular formula C31H26N4O7 and a molecular weight of 566.57 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-methoxy-4-[[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4249535 |
| Molecular Formula | C31H26N4O7 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | [2-methoxy-4-[[[2-oxo-2-[2-(phenylcarbamoyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3ccccc3C(=O)Nc3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C31H26N4O7/c1-40-23-15-13-21(14-16-23)31(39)42-26-17-12-20(18-27(26)41-2)19-32-35-30(38)29(37)34-25-11-7-6-10-24(25)28(36)33-22-8-4-3-5-9-22/h3-19H,1-2H3,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | VSJNHFBJAUZZGW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|