C27H27N3O7 — CID 4984769
[2-ethoxy-4-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate (PubChem CID 4984769) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is [2-ethoxy-4-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [2-ethoxy-4-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 4984769 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [2-ethoxy-4-[[[2-(2-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3ccccc3OC)cc2OCC)cc1 |
| InChI | InChI=1S/C27H27N3O7/c1-4-35-20-13-11-19(12-14-20)27(33)37-23-15-10-18(16-24(23)36-5-2)17-28-30-26(32)25(31)29-21-8-6-7-9-22(21)34-3/h6-17H,4-5H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | SYPFADFFEOKJNC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|