C26H26N2O6 — CID 5044572
[2-ethoxy-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate (PubChem CID 5044572) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is [2-ethoxy-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [2-ethoxy-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 5044572 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [2-ethoxy-4-[[(4-methoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3ccc(OC)cc3)cc2OCC)cc1 |
| InChI | InChI=1S/C26H26N2O6/c1-4-32-22-13-9-20(10-14-22)26(30)34-23-15-6-18(16-24(23)33-5-2)17-27-28-25(29)19-7-11-21(31-3)12-8-19/h6-17H,4-5H2,1-3H3,(H,28,29) |
| InChIKey | USJRZHRIFLCUKU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|