C27H28N2O7 — CID 3777566
[4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-ethoxybenzoate (PubChem CID 3777566) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-ethoxybenzoate.
| Compound Name | [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3777566 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3ccc(OC)c(OC)c3)cc2OCC)cc1 |
| InChI | InChI=1S/C27H28N2O7/c1-5-34-21-11-8-19(9-12-21)27(31)36-23-13-7-18(15-25(23)35-6-2)17-28-29-26(30)20-10-14-22(32-3)24(16-20)33-4/h7-17H,5-6H2,1-4H3,(H,29,30) |
| InChIKey | SCJPJVGEMOUKKD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|