C28H30N2O9 — CID 6129052
[2-ethoxy-4-[(Z)-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 6129052) has the molecular formula C28H30N2O9 and a molecular weight of 538.55 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 6129052 |
| Molecular Formula | C28H30N2O9 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[(3,4,5-trimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H30N2O9/c1-7-38-23-12-17(8-10-21(23)39-28(32)18-9-11-20(33-2)22(13-18)34-3)16-29-30-27(31)19-14-24(35-4)26(37-6)25(15-19)36-5/h8-16H,7H2,1-6H3,(H,30,31)/b29-16- |
| InChIKey | JYORYTPIMZRAEN-MWLSYYOVSA-N |
| XLogP | 4.11 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|