C25H24N2O6 — CID 4255849
[4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate (PubChem CID 4255849) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 4255849 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [4-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2ccc(OC)c(OC)c2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O6/c1-4-32-23-14-17(10-12-21(23)33-25(29)18-8-6-5-7-9-18)16-26-27-24(28)19-11-13-20(30-2)22(15-19)31-3/h5-16H,4H2,1-3H3,(H,27,28) |
| InChIKey | FUTFPGROEWHXMH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|