C24H24N2O7S — CID 126330575
[4-[(E)-[(3-ethoxy-4-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate (PubChem CID 126330575) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is [4-[(E)-[(3-ethoxy-4-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-[(E)-[(3-ethoxy-4-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126330575 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [4-[(E)-[(3-ethoxy-4-methoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
| SMILES | CCOc1cc(C(=O)N/N=C/c2ccc(OS(=O)(=O)c3ccccc3)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C24H24N2O7S/c1-4-32-23-15-18(11-13-20(23)30-2)24(27)26-25-16-17-10-12-21(22(14-17)31-3)33-34(28,29)19-8-6-5-7-9-19/h5-16H,4H2,1-3H3,(H,26,27)/b25-16+ |
| InChIKey | SUWSGXMPJHMZJA-PCLIKHOPSA-N |
| XLogP | 3.63 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|