C21H18N2O6S — CID 6255411
[4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate (PubChem CID 6255411) has the molecular formula C21H18N2O6S and a molecular weight of 426.45 g/mol. Its IUPAC name is [4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 6255411 |
| Molecular Formula | C21H18N2O6S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [4-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(/C=N\NC(=O)c2ccccc2O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O6S/c1-28-20-13-15(14-22-23-21(25)17-9-5-6-10-18(17)24)11-12-19(20)29-30(26,27)16-7-3-2-4-8-16/h2-14,24H,1H3,(H,23,25)/b22-14- |
| InChIKey | TVMUCICGKDIGAL-HMAPJEAMSA-N |
| XLogP | 2.93 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|