C16H15ClN2O4 — CID 5057069
5-chloro-N-[(3,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 5057069) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is 5-chloro-N-[(3,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[(3,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 5057069 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-chloro-N-[(3,4-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cc(Cl)ccc2O)cc1OC |
| InChI | InChI=1S/C16H15ClN2O4/c1-22-14-6-3-10(7-15(14)23-2)9-18-19-16(21)12-8-11(17)4-5-13(12)20/h3-9,20H,1-2H3,(H,19,21) |
| InChIKey | MJPDLQHKKPFJSG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|