C15H13ClN2O4 — CID 840452
5-chloro-N-[(3,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide (PubChem CID 840452) has the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. Its IUPAC name is 5-chloro-N-[(3,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[(3,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 840452 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-chloro-N-[(3,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NN=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H13ClN2O4/c1-22-14-5-3-10(16)7-11(14)15(21)18-17-8-9-2-4-12(19)13(20)6-9/h2-8,19-20H,1H3,(H,18,21) |
| InChIKey | OJLNEWYZIBNJCL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|