C17H16BrClN2O4 — CID 6737092
N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-5-chloro-2-methoxybenzamide (PubChem CID 6737092) has the molecular formula C17H16BrClN2O4 and a molecular weight of 427.68 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-5-chloro-2-methoxybenzamide.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 6737092 |
| Molecular Formula | C17H16BrClN2O4 |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-5-chloro-2-methoxybenzamide |
| SMILES | COc1cc(Br)c(C=NNC(=O)c2cc(Cl)ccc2OC)cc1OC |
| InChI | InChI=1S/C17H16BrClN2O4/c1-23-14-5-4-11(19)7-12(14)17(22)21-20-9-10-6-15(24-2)16(25-3)8-13(10)18/h4-9H,1-3H3,(H,21,22) |
| InChIKey | XZPBWIAKQVXOIU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|