C16H15BrN2O4 — CID 9077699
N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 9077699) has the molecular formula C16H15BrN2O4 and a molecular weight of 379.21 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 9077699 |
| Molecular Formula | C16H15BrN2O4 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | COc1cc(Br)c(/C=N\NC(=O)c2ccccc2O)cc1OC |
| InChI | InChI=1S/C16H15BrN2O4/c1-22-14-7-10(12(17)8-15(14)23-2)9-18-19-16(21)11-5-3-4-6-13(11)20/h3-9,20H,1-2H3,(H,19,21)/b18-9- |
| InChIKey | ZIVNSBBSRTVQAR-NVMNQCDNSA-N |
| XLogP | 2.94 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|