C17H17BrN2O3 — CID 3594626
2-bromo-N-[(4,5-dimethoxy-2-methylphenyl)methylideneamino]benzamide (PubChem CID 3594626) has the molecular formula C17H17BrN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is 2-bromo-N-[(4,5-dimethoxy-2-methylphenyl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(4,5-dimethoxy-2-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3594626 |
| Molecular Formula | C17H17BrN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-bromo-N-[(4,5-dimethoxy-2-methylphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(C)c(C=NNC(=O)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C17H17BrN2O3/c1-11-8-15(22-2)16(23-3)9-12(11)10-19-20-17(21)13-6-4-5-7-14(13)18/h4-10H,1-3H3,(H,20,21) |
| InChIKey | SWGPAMLONDQODG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|