C20H17BrN2O3 — CID 5430737
N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]naphthalene-1-carboxamide (PubChem CID 5430737) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]naphthalene-1-carboxamide.
| Compound Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 5430737 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[(Z)-(2-bromo-4,5-dimethoxyphenyl)methylideneamino]naphthalene-1-carboxamide |
| SMILES | COc1cc(Br)c(/C=N\NC(=O)c2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C20H17BrN2O3/c1-25-18-10-14(17(21)11-19(18)26-2)12-22-23-20(24)16-9-5-7-13-6-3-4-8-15(13)16/h3-12H,1-2H3,(H,23,24)/b22-12- |
| InChIKey | YQSRYFNGKFYUNV-UUYOSTAYSA-N |
| XLogP | 4.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|