C22H19BrN2O6 — CID 4274415
2-[5-bromo-2-methoxy-4-[[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 4274415) has the molecular formula C22H19BrN2O6 and a molecular weight of 487.31 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-[[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-methoxy-4-[[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 4274415 |
| Molecular Formula | C22H19BrN2O6 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-[[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=NNC(=O)c2cc3ccccc3cc2OC)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C22H19BrN2O6/c1-29-18-8-14-6-4-3-5-13(14)7-16(18)22(28)25-24-11-15-9-19(30-2)20(10-17(15)23)31-12-21(26)27/h3-11H,12H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | NVWRBHYLZFHTAJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|