C28H23BrCl2N2O4 — CID 126378512
N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126378512) has the molecular formula C28H23BrCl2N2O4 and a molecular weight of 602.31 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126378512 |
| Molecular Formula | C28H23BrCl2N2O4 |
| Molecular Weight | 602.31 g/mol |
| Exact Mass | 600.02 |
| IUPAC Name | N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H23BrCl2N2O4/c1-3-36-26-12-20(23(29)14-27(26)37-16-19-8-9-21(30)13-24(19)31)15-32-33-28(34)22-10-17-6-4-5-7-18(17)11-25(22)35-2/h4-15H,3,16H2,1-2H3,(H,33,34)/b32-15- |
| InChIKey | WHDFTMJGMHZZNF-CNCDYAKUSA-N |
| XLogP | 7.66 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.31 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|