C24H21BrCl2N2O4 — CID 126328663
N-[(E)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126328663) has the molecular formula C24H21BrCl2N2O4 and a molecular weight of 552.25 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126328663 |
| Molecular Formula | C24H21BrCl2N2O4 |
| Molecular Weight | 552.25 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | N-[(E)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C24H21BrCl2N2O4/c1-3-32-22-8-5-15(11-23(22)31-2)24(30)29-28-13-17-10-18(25)6-9-21(17)33-14-16-4-7-19(26)12-20(16)27/h4-13H,3,14H2,1-2H3,(H,29,30)/b28-13+ |
| InChIKey | KFJYIMOZWJCZDD-XODNFHPESA-N |
| XLogP | 6.51 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.25 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|