C27H27Cl3N2O5 — CID 126322868
N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide (PubChem CID 126322868) has the molecular formula C27H27Cl3N2O5 and a molecular weight of 565.88 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126322868 |
| Molecular Formula | C27H27Cl3N2O5 |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-3-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C27H27Cl3N2O5/c1-4-10-36-23-9-7-18(13-24(23)35-5-2)27(33)32-31-15-17-11-22(30)26(25(12-17)34-3)37-16-19-6-8-20(28)14-21(19)29/h6-9,11-15H,4-5,10,16H2,1-3H3,(H,32,33)/b31-15+ |
| InChIKey | ZLKDGPHYGJELOR-IBBHUPRXSA-N |
| XLogP | 7.19 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|