C23H25ClN2O5 — CID 126309772
N-[(E)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-3-ethoxy-4-propoxybenzamide (PubChem CID 126309772) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-3-ethoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-3-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126309772 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[(E)-(3-chloro-5-methoxy-4-prop-2-ynoxyphenyl)methylideneamino]-3-ethoxy-4-propoxybenzamide |
| SMILES | C#CCOc1c(Cl)cc(/C=N/NC(=O)c2ccc(OCCC)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C23H25ClN2O5/c1-5-10-30-19-9-8-17(14-20(19)29-7-3)23(27)26-25-15-16-12-18(24)22(31-11-6-2)21(13-16)28-4/h2,8-9,12-15H,5,7,10-11H2,1,3-4H3,(H,26,27)/b25-15+ |
| InChIKey | NSNIKDVNBDFEJF-MFKUBSTISA-N |
| XLogP | 4.31 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|